C17H21N3O3 — CID 68805308
tert-butyl 2-[(4-cyanophenyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 68805308) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is tert-butyl 2-[(4-cyanophenyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(4-cyanophenyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 68805308 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | tert-butyl 2-[(4-cyanophenyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H21N3O3/c1-17(2,3)23-16(22)20-10-4-5-14(20)15(21)19-13-8-6-12(11-18)7-9-13/h6-9,14H,4-5,10H2,1-3H3,(H,19,21) |
| InChIKey | XSMPFSIHOGPCFT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |