C16H21F5N2O3S — CID 155819065
tert-butyl 2-[[4-(pentafluoro-λ6-sulfanyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 155819065) has the molecular formula C16H21F5N2O3S and a molecular weight of 416.41 g/mol. Its IUPAC name is tert-butyl 2-[[4-(pentafluoro-λ6-sulfanyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[4-(pentafluoro-λ6-sulfanyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 155819065 |
| Molecular Formula | C16H21F5N2O3S |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | tert-butyl 2-[[4-(pentafluoro-λ6-sulfanyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)Nc1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C16H21F5N2O3S/c1-16(2,3)26-15(25)23-10-4-5-13(23)14(24)22-11-6-8-12(9-7-11)27(17,18,19,20)21/h6-9,13H,4-5,10H2,1-3H3,(H,22,24) |
| InChIKey | ANOQFDJHYSTORC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |