C24H26N2O3 — CID 143190861
tert-butyl (2R)-2-[[4-(2-phenylethynyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 143190861) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[4-(2-phenylethynyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[4-(2-phenylethynyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 143190861 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | tert-butyl (2R)-2-[[4-(2-phenylethynyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1C(=O)Nc1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H26N2O3/c1-24(2,3)29-23(28)26-17-7-10-21(26)22(27)25-20-15-13-19(14-16-20)12-11-18-8-5-4-6-9-18/h4-6,8-9,13-16,21H,7,10,17H2,1-3H3,(H,25,27)/t21-/m1/s1 |
| InChIKey | DEAKQBWWDZECHP-OAQYLSRUSA-N |
| XLogP | 4.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|