C27H32N2O3 — CID 143190880
tert-butyl (2R)-2-[[4-[2-(2-ethyl-4-methylphenyl)ethynyl]phenyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 143190880) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[4-[2-(2-ethyl-4-methylphenyl)ethynyl]phenyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[4-[2-(2-ethyl-4-methylphenyl)ethynyl]phenyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 143190880 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | tert-butyl (2R)-2-[[4-[2-(2-ethyl-4-methylphenyl)ethynyl]phenyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CCc1cc(C)ccc1C#Cc1ccc(NC(=O)[C@H]2CCCN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H32N2O3/c1-6-21-18-19(2)9-13-22(21)14-10-20-11-15-23(16-12-20)28-25(30)24-8-7-17-29(24)26(31)32-27(3,4)5/h9,11-13,15-16,18,24H,6-8,17H2,1-5H3,(H,28,30)/t24-/m1/s1 |
| InChIKey | RSDUGJCXVSXSNN-XMMPIXPASA-N |
| XLogP | 5.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|