C19H26N2O5 — CID 110426719
tert-butyl 2-[(4-ethoxycarbonylphenyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 110426719) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is tert-butyl 2-[(4-ethoxycarbonylphenyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(4-ethoxycarbonylphenyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 110426719 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | tert-butyl 2-[(4-ethoxycarbonylphenyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C2CCCN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H26N2O5/c1-5-25-17(23)13-8-10-14(11-9-13)20-16(22)15-7-6-12-21(15)18(24)26-19(2,3)4/h8-11,15H,5-7,12H2,1-4H3,(H,20,22) |
| InChIKey | PJQRNHQASUSIOS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |