C20H26FNO4 — CID 146165538
tert-butyl 2-[2-(4-ethoxycarbonylphenyl)-1-fluoroethenyl]pyrrolidine-1-carboxylate (PubChem CID 146165538) has the molecular formula C20H26FNO4 and a molecular weight of 363.43 g/mol. Its IUPAC name is tert-butyl 2-[2-(4-ethoxycarbonylphenyl)-1-fluoroethenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(4-ethoxycarbonylphenyl)-1-fluoroethenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146165538 |
| Molecular Formula | C20H26FNO4 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | tert-butyl 2-[2-(4-ethoxycarbonylphenyl)-1-fluoroethenyl]pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)c1ccc(C=C(F)C2CCCN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H26FNO4/c1-5-25-18(23)15-10-8-14(9-11-15)13-16(21)17-7-6-12-22(17)19(24)26-20(2,3)4/h8-11,13,17H,5-7,12H2,1-4H3 |
| InChIKey | DBHBTAMIPZEEOZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |