C20H28N2O5 — CID 98990393
tert-butyl (2R)-2-[(4-methoxycarbonylphenyl)methylcarbamoyl]piperidine-1-carboxylate (PubChem CID 98990393) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(4-methoxycarbonylphenyl)methylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(4-methoxycarbonylphenyl)methylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 98990393 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | tert-butyl (2R)-2-[(4-methoxycarbonylphenyl)methylcarbamoyl]piperidine-1-carboxylate |
| SMILES | COC(=O)c1ccc(CNC(=O)[C@H]2CCCCN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H28N2O5/c1-20(2,3)27-19(25)22-12-6-5-7-16(22)17(23)21-13-14-8-10-15(11-9-14)18(24)26-4/h8-11,16H,5-7,12-13H2,1-4H3,(H,21,23)/t16-/m1/s1 |
| InChIKey | UYLOZDPEWNGXPS-MRXNPFEDSA-N |
| XLogP | 2.88 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |