C21H28N2O7 — CID 11908637
1-O-tert-butyl 2-O-[2-[(4-methoxycarbonylphenyl)methylamino]-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 11908637) has the molecular formula C21H28N2O7 and a molecular weight of 420.46 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-[2-[(4-methoxycarbonylphenyl)methylamino]-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-[2-[(4-methoxycarbonylphenyl)methylamino]-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11908637 |
| Molecular Formula | C21H28N2O7 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 1-O-tert-butyl 2-O-[2-[(4-methoxycarbonylphenyl)methylamino]-2-oxoethyl] (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(CNC(=O)COC(=O)[C@@H]2CCCN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H28N2O7/c1-21(2,3)30-20(27)23-11-5-6-16(23)19(26)29-13-17(24)22-12-14-7-9-15(10-8-14)18(25)28-4/h7-10,16H,5-6,11-13H2,1-4H3,(H,22,24)/t16-/m0/s1 |
| InChIKey | FHARBDGSNNZYPF-INIZCTEOSA-N |
| XLogP | 2.03 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|