C15H24N4O3 — CID 94809182
tert-butyl (2R)-2-(1H-pyrazol-5-ylmethylcarbamoyl)piperidine-1-carboxylate (PubChem CID 94809182) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is tert-butyl (2R)-2-(1H-pyrazol-5-ylmethylcarbamoyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-(1H-pyrazol-5-ylmethylcarbamoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 94809182 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | tert-butyl (2R)-2-(1H-pyrazol-5-ylmethylcarbamoyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@@H]1C(=O)NCc1ccn[nH]1 |
| InChI | InChI=1S/C15H24N4O3/c1-15(2,3)22-14(21)19-9-5-4-6-12(19)13(20)16-10-11-7-8-17-18-11/h7-8,12H,4-6,9-10H2,1-3H3,(H,16,20)(H,17,18)/t12-/m1/s1 |
| InChIKey | FFNCITJODMXNIF-GFCCVEGCSA-N |
| XLogP | 1.82 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |