C12H20N6O3 — CID 122580563
tert-butyl (2S)-2-(2H-tetrazol-5-ylmethylcarbamoyl)pyrrolidine-1-carboxylate (PubChem CID 122580563) has the molecular formula C12H20N6O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is tert-butyl (2S)-2-(2H-tetrazol-5-ylmethylcarbamoyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(2H-tetrazol-5-ylmethylcarbamoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 122580563 |
| Molecular Formula | C12H20N6O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | tert-butyl (2S)-2-(2H-tetrazol-5-ylmethylcarbamoyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)NCc1nn[nH]n1 |
| InChI | InChI=1S/C12H20N6O3/c1-12(2,3)21-11(20)18-6-4-5-8(18)10(19)13-7-9-14-16-17-15-9/h8H,4-7H2,1-3H3,(H,13,19)(H,14,15,16,17)/t8-/m0/s1 |
| InChIKey | AKURHVBYWMDJOY-QMMMGPOBSA-N |
| XLogP | 0.22 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |