C17H23NO4 — CID 87040071
1-O-tert-butyl 2-O-(3-methylphenyl) (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 87040071) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-(3-methylphenyl) (2S)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-(3-methylphenyl) (2S)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 87040071 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 1-O-tert-butyl 2-O-(3-methylphenyl) (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | Cc1cccc(OC(=O)[C@@H]2CCCN2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H23NO4/c1-12-7-5-8-13(11-12)21-15(19)14-9-6-10-18(14)16(20)22-17(2,3)4/h5,7-8,11,14H,6,9-10H2,1-4H3/t14-/m0/s1 |
| InChIKey | QKBQZKUHQLTMKR-AWEZNQCLSA-N |
| XLogP | 3.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|