C30H44N4O10S — CID 20768098
ethyl 2-[[[1-[2-[2-acetamido-3-(4-nitrooxybutoxy)-3-oxopropyl]sulfanylcarbonylpyrrolidin-1-yl]-1-oxopropan-2-yl]amino]methyl]-4-phenylbutanoate (PubChem CID 20768098) has the molecular formula C30H44N4O10S and a molecular weight of 652.77 g/mol. Its IUPAC name is ethyl 2-[[[1-[2-[2-acetamido-3-(4-nitrooxybutoxy)-3-oxopropyl]sulfanylcarbonylpyrrolidin-1-yl]-1-oxopropan-2-yl]amino]methyl]-4-phenylbutanoate.
| Compound Name | ethyl 2-[[[1-[2-[2-acetamido-3-(4-nitrooxybutoxy)-3-oxopropyl]sulfanylcarbonylpyrrolidin-1-yl]-1-oxopropan-2-yl]amino]methyl]-4-phenylbutanoate |
|---|---|
| PubChem CID | 20768098 |
| Molecular Formula | C30H44N4O10S |
| Molecular Weight | 652.77 g/mol |
| Exact Mass | 652.28 |
| IUPAC Name | ethyl 2-[[[1-[2-[2-acetamido-3-(4-nitrooxybutoxy)-3-oxopropyl]sulfanylcarbonylpyrrolidin-1-yl]-1-oxopropan-2-yl]amino]methyl]-4-phenylbutanoate |
| SMILES | CCOC(=O)C(CCc1ccccc1)CNC(C)C(=O)N1CCCC1C(=O)SCC(NC(C)=O)C(=O)OCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C30H44N4O10S/c1-4-42-28(37)24(15-14-23-11-6-5-7-12-23)19-31-21(2)27(36)33-16-10-13-26(33)30(39)45-20-25(32-22(3)35)29(38)43-17-8-9-18-44-34(40)41/h5-7,11-12,21,24-26,31H,4,8-10,13-20H2,1-3H3,(H,32,35) |
| InChIKey | CSNBQTKALNBRLY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 183.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.77 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|