C27H40N4O8 — CID 58862187
5-nitrooxypentyl 7-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-6-oxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepine-4-carboxylate (PubChem CID 58862187) has the molecular formula C27H40N4O8 and a molecular weight of 548.64 g/mol. Its IUPAC name is 5-nitrooxypentyl 7-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-6-oxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepine-4-carboxylate.
| Compound Name | 5-nitrooxypentyl 7-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-6-oxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepine-4-carboxylate |
|---|---|
| PubChem CID | 58862187 |
| Molecular Formula | C27H40N4O8 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | 5-nitrooxypentyl 7-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-6-oxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepine-4-carboxylate |
| SMILES | CCOC(=O)C(CCc1ccccc1)NC1CCCN2CCCC(C(=O)OCCCCCO[N+](=O)[O-])N2C1=O |
| InChI | InChI=1S/C27H40N4O8/c1-2-37-26(33)23(16-15-21-11-5-3-6-12-21)28-22-13-9-17-29-18-10-14-24(30(29)25(22)32)27(34)38-19-7-4-8-20-39-31(35)36/h3,5-6,11-12,22-24,28H,2,4,7-10,13-20H2,1H3 |
| InChIKey | JGMLOQJFFDGDMJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|