C34H56N4O5 — CID 70403498
tert-butyl (4S,7S)-7-[[(2S)-4-(4-aminophenyl)-1-decoxy-1-oxobutan-2-yl]amino]-6-oxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepine-4-carboxylate (PubChem CID 70403498) has the molecular formula C34H56N4O5 and a molecular weight of 600.85 g/mol. Its IUPAC name is tert-butyl (4S,7S)-7-[[(2S)-4-(4-aminophenyl)-1-decoxy-1-oxobutan-2-yl]amino]-6-oxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepine-4-carboxylate.
| Compound Name | tert-butyl (4S,7S)-7-[[(2S)-4-(4-aminophenyl)-1-decoxy-1-oxobutan-2-yl]amino]-6-oxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepine-4-carboxylate |
|---|---|
| PubChem CID | 70403498 |
| Molecular Formula | C34H56N4O5 |
| Molecular Weight | 600.85 g/mol |
| Exact Mass | 600.43 |
| IUPAC Name | tert-butyl (4S,7S)-7-[[(2S)-4-(4-aminophenyl)-1-decoxy-1-oxobutan-2-yl]amino]-6-oxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepine-4-carboxylate |
| SMILES | CCCCCCCCCCOC(=O)[C@H](CCc1ccc(N)cc1)N[C@H]1CCCN2CCC[C@@H](C(=O)OC(C)(C)C)N2C1=O |
| InChI | InChI=1S/C34H56N4O5/c1-5-6-7-8-9-10-11-12-25-42-32(40)29(22-19-26-17-20-27(35)21-18-26)36-28-15-13-23-37-24-14-16-30(38(37)31(28)39)33(41)43-34(2,3)4/h17-18,20-21,28-30,36H,5-16,19,22-25,35H2,1-4H3/t28-,29-,30-/m0/s1 |
| InChIKey | DJBXGOZUBRWACJ-DTXPUJKBSA-N |
| XLogP | 5.56 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.85 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|