C23H34N4O7 — CID 89202795
3-(dihydroxyamino)oxypropyl 2-[(4-formyl-6-oxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepin-7-yl)amino]-4-phenylbutanoate (PubChem CID 89202795) has the molecular formula C23H34N4O7 and a molecular weight of 478.55 g/mol. Its IUPAC name is 3-(dihydroxyamino)oxypropyl 2-[(4-formyl-6-oxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepin-7-yl)amino]-4-phenylbutanoate.
| Compound Name | 3-(dihydroxyamino)oxypropyl 2-[(4-formyl-6-oxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepin-7-yl)amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 89202795 |
| Molecular Formula | C23H34N4O7 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 3-(dihydroxyamino)oxypropyl 2-[(4-formyl-6-oxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepin-7-yl)amino]-4-phenylbutanoate |
| SMILES | O=CC1CCCN2CCCC(NC(CCc3ccccc3)C(=O)OCCCON(O)O)C(=O)N12 |
| InChI | InChI=1S/C23H34N4O7/c28-17-19-9-4-13-25-14-5-10-20(22(29)26(19)25)24-21(12-11-18-7-2-1-3-8-18)23(30)33-15-6-16-34-27(31)32/h1-3,7-8,17,19-21,24,31-32H,4-6,9-16H2 |
| InChIKey | QWCVKIHIFHMGLT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|