C26H40N4O8 — CID 58818728
2-[methyl(2-nitrooxyethyl)amino]ethyl (2R)-1-[(2S)-2-[[(2R)-2-ethoxycarbonyl-4-phenylbutyl]amino]propanoyl]pyrrolidine-2-carboxylate (PubChem CID 58818728) has the molecular formula C26H40N4O8 and a molecular weight of 536.63 g/mol. Its IUPAC name is 2-[methyl(2-nitrooxyethyl)amino]ethyl (2R)-1-[(2S)-2-[[(2R)-2-ethoxycarbonyl-4-phenylbutyl]amino]propanoyl]pyrrolidine-2-carboxylate.
| Compound Name | 2-[methyl(2-nitrooxyethyl)amino]ethyl (2R)-1-[(2S)-2-[[(2R)-2-ethoxycarbonyl-4-phenylbutyl]amino]propanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 58818728 |
| Molecular Formula | C26H40N4O8 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | 2-[methyl(2-nitrooxyethyl)amino]ethyl (2R)-1-[(2S)-2-[[(2R)-2-ethoxycarbonyl-4-phenylbutyl]amino]propanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)CN[C@@H](C)C(=O)N1CCC[C@@H]1C(=O)OCCN(C)CCO[N+](=O)[O-] |
| InChI | InChI=1S/C26H40N4O8/c1-4-36-25(32)22(13-12-21-9-6-5-7-10-21)19-27-20(2)24(31)29-14-8-11-23(29)26(33)37-17-15-28(3)16-18-38-30(34)35/h5-7,9-10,20,22-23,27H,4,8,11-19H2,1-3H3/t20-,22+,23+/m0/s1 |
| InChIKey | QKZWNMOSHJQLRL-MDNUFGMLSA-N |
| XLogP | 1.45 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|