C23H34N2O5 — CID 54121581
ethyl (2S)-1-[(2-ethoxycarbonyl-4-phenylbutyl)-ethylcarbamoyl]pyrrolidine-2-carboxylate (PubChem CID 54121581) has the molecular formula C23H34N2O5 and a molecular weight of 418.53 g/mol. Its IUPAC name is ethyl (2S)-1-[(2-ethoxycarbonyl-4-phenylbutyl)-ethylcarbamoyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S)-1-[(2-ethoxycarbonyl-4-phenylbutyl)-ethylcarbamoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 54121581 |
| Molecular Formula | C23H34N2O5 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | ethyl (2S)-1-[(2-ethoxycarbonyl-4-phenylbutyl)-ethylcarbamoyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C(CCc1ccccc1)CN(CC)C(=O)N1CCC[C@H]1C(=O)OCC |
| InChI | InChI=1S/C23H34N2O5/c1-4-24(23(28)25-16-10-13-20(25)22(27)30-6-3)17-19(21(26)29-5-2)15-14-18-11-8-7-9-12-18/h7-9,11-12,19-20H,4-6,10,13-17H2,1-3H3/t19?,20-/m0/s1 |
| InChIKey | NOBNQNYZDBXCPS-ANYOKISRSA-N |
| XLogP | 3.27 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |