C29H32N2O3 — CID 57386993
ethyl (2S)-1-[(2R)-2-(dibenzylamino)-2-phenylacetyl]pyrrolidine-2-carboxylate (PubChem CID 57386993) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is ethyl (2S)-1-[(2R)-2-(dibenzylamino)-2-phenylacetyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S)-1-[(2R)-2-(dibenzylamino)-2-phenylacetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57386993 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | ethyl (2S)-1-[(2R)-2-(dibenzylamino)-2-phenylacetyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN1C(=O)[C@@H](c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H32N2O3/c1-2-34-29(33)26-19-12-20-31(26)28(32)27(25-17-10-5-11-18-25)30(21-23-13-6-3-7-14-23)22-24-15-8-4-9-16-24/h3-11,13-18,26-27H,2,12,19-22H2,1H3/t26-,27+/m0/s1 |
| InChIKey | GYBLZIMAABBNQC-RRPNLBNLSA-N |
| XLogP | 4.98 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |