C30H34N2O3 — CID 57386995
propyl (2S)-1-[(2R)-2-(dibenzylamino)-2-phenylacetyl]pyrrolidine-2-carboxylate (PubChem CID 57386995) has the molecular formula C30H34N2O3 and a molecular weight of 470.61 g/mol. Its IUPAC name is propyl (2S)-1-[(2R)-2-(dibenzylamino)-2-phenylacetyl]pyrrolidine-2-carboxylate.
| Compound Name | propyl (2S)-1-[(2R)-2-(dibenzylamino)-2-phenylacetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57386995 |
| Molecular Formula | C30H34N2O3 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | propyl (2S)-1-[(2R)-2-(dibenzylamino)-2-phenylacetyl]pyrrolidine-2-carboxylate |
| SMILES | CCCOC(=O)[C@@H]1CCCN1C(=O)[C@@H](c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C30H34N2O3/c1-2-21-35-30(34)27-19-12-20-32(27)29(33)28(26-17-10-5-11-18-26)31(22-24-13-6-3-7-14-24)23-25-15-8-4-9-16-25/h3-11,13-18,27-28H,2,12,19-23H2,1H3/t27-,28+/m0/s1 |
| InChIKey | ZLSXKYDNMVRQFI-WUFINQPMSA-N |
| XLogP | 5.37 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |