C19H27N3O5 — CID 14537401
(2S)-1-[[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-methylcarbamoyl]pyrrolidine-2-carboxylic acid (PubChem CID 14537401) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is (2S)-1-[[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-methylcarbamoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-methylcarbamoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 14537401 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (2S)-1-[[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-methylcarbamoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)NN(C)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C19H27N3O5/c1-3-27-18(25)15(12-11-14-8-5-4-6-9-14)20-21(2)19(26)22-13-7-10-16(22)17(23)24/h4-6,8-9,15-16,20H,3,7,10-13H2,1-2H3,(H,23,24)/t15-,16-/m0/s1 |
| InChIKey | CUKPBFBSMOVFGY-HOTGVXAUSA-N |
| XLogP | 1.66 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|