C24H30N2O9 — CID 70045946
(E)-2-[(2R)-2-carboxypyrrolidin-1-yl]-3-[(2R)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]but-2-enedioic acid (PubChem CID 70045946) has the molecular formula C24H30N2O9 and a molecular weight of 490.51 g/mol. Its IUPAC name is (E)-2-[(2R)-2-carboxypyrrolidin-1-yl]-3-[(2R)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]but-2-enedioic acid.
| Compound Name | (E)-2-[(2R)-2-carboxypyrrolidin-1-yl]-3-[(2R)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 70045946 |
| Molecular Formula | C24H30N2O9 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | (E)-2-[(2R)-2-carboxypyrrolidin-1-yl]-3-[(2R)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]but-2-enedioic acid |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@H](C)C(=O)/C(C(=O)O)=C(/C(=O)O)N1CCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C24H30N2O9/c1-3-35-24(34)16(12-11-15-8-5-4-6-9-15)25-14(2)20(27)18(22(30)31)19(23(32)33)26-13-7-10-17(26)21(28)29/h4-6,8-9,14,16-17,25H,3,7,10-13H2,1-2H3,(H,28,29)(H,30,31)(H,32,33)/b19-18+/t14-,16+,17-/m1/s1 |
| InChIKey | UFYMIQQMORYBJE-QDPIZYMNSA-N |
| XLogP | 1.07 |
| TPSA | 170.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|