C28H37N3O5 — CID 57046536
tert-butyl 1-[methyl-[(1-oxo-4-phenyl-1-phenylmethoxybutan-2-yl)amino]carbamoyl]pyrrolidine-2-carboxylate (PubChem CID 57046536) has the molecular formula C28H37N3O5 and a molecular weight of 495.62 g/mol. Its IUPAC name is tert-butyl 1-[methyl-[(1-oxo-4-phenyl-1-phenylmethoxybutan-2-yl)amino]carbamoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl 1-[methyl-[(1-oxo-4-phenyl-1-phenylmethoxybutan-2-yl)amino]carbamoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57046536 |
| Molecular Formula | C28H37N3O5 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | tert-butyl 1-[methyl-[(1-oxo-4-phenyl-1-phenylmethoxybutan-2-yl)amino]carbamoyl]pyrrolidine-2-carboxylate |
| SMILES | CN(NC(CCc1ccccc1)C(=O)OCc1ccccc1)C(=O)N1CCCC1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H37N3O5/c1-28(2,3)36-26(33)24-16-11-19-31(24)27(34)30(4)29-23(18-17-21-12-7-5-8-13-21)25(32)35-20-22-14-9-6-10-15-22/h5-10,12-15,23-24,29H,11,16-20H2,1-4H3 |
| InChIKey | PRDCXPCKELEKSM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|