C30H39N3O8 — CID 11215233
5-nitrooxypentyl 2-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate (PubChem CID 11215233) has the molecular formula C30H39N3O8 and a molecular weight of 569.66 g/mol. Its IUPAC name is 5-nitrooxypentyl 2-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate.
| Compound Name | 5-nitrooxypentyl 2-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 11215233 |
| Molecular Formula | C30H39N3O8 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | 5-nitrooxypentyl 2-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| SMILES | CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N1Cc2ccccc2CC1C(=O)OCCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C30H39N3O8/c1-3-39-29(35)26(17-16-23-12-6-4-7-13-23)31-22(2)28(34)32-21-25-15-9-8-14-24(25)20-27(32)30(36)40-18-10-5-11-19-41-33(37)38/h4,6-9,12-15,22,26-27,31H,3,5,10-11,16-21H2,1-2H3 |
| InChIKey | QEKMXRMLILVNKT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|