C28H35N3O8S — CID 142974856
2-[2-[[1-[2-(2-nitrooxyethylsulfanyl)ethoxy]-2-oxo-5-phenylpentan-3-yl]amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 142974856) has the molecular formula C28H35N3O8S and a molecular weight of 573.67 g/mol. Its IUPAC name is 2-[2-[[1-[2-(2-nitrooxyethylsulfanyl)ethoxy]-2-oxo-5-phenylpentan-3-yl]amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | 2-[2-[[1-[2-(2-nitrooxyethylsulfanyl)ethoxy]-2-oxo-5-phenylpentan-3-yl]amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 142974856 |
| Molecular Formula | C28H35N3O8S |
| Molecular Weight | 573.67 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | 2-[2-[[1-[2-(2-nitrooxyethylsulfanyl)ethoxy]-2-oxo-5-phenylpentan-3-yl]amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | CC(NC(CCc1ccccc1)C(=O)COCCSCCO[N+](=O)[O-])C(=O)N1Cc2ccccc2CC1C(=O)O |
| InChI | InChI=1S/C28H35N3O8S/c1-20(27(33)30-18-23-10-6-5-9-22(23)17-25(30)28(34)35)29-24(12-11-21-7-3-2-4-8-21)26(32)19-38-13-15-40-16-14-39-31(36)37/h2-10,20,24-25,29H,11-19H2,1H3,(H,34,35) |
| InChIKey | VXAIOLNNYFAMFD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.67 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|