C26H31N3O8S — CID 11168771
1-[2-[[1-[2-(2-nitrooxyethylsulfanyl)ethoxy]-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-2,3-dihydroindole-2-carboxylic acid (PubChem CID 11168771) has the molecular formula C26H31N3O8S and a molecular weight of 545.61 g/mol. Its IUPAC name is 1-[2-[[1-[2-(2-nitrooxyethylsulfanyl)ethoxy]-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | 1-[2-[[1-[2-(2-nitrooxyethylsulfanyl)ethoxy]-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 11168771 |
| Molecular Formula | C26H31N3O8S |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | 1-[2-[[1-[2-(2-nitrooxyethylsulfanyl)ethoxy]-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-2,3-dihydroindole-2-carboxylic acid |
| SMILES | CC(NC(CCc1ccccc1)C(=O)OCCSCCO[N+](=O)[O-])C(=O)N1c2ccccc2CC1C(=O)O |
| InChI | InChI=1S/C26H31N3O8S/c1-18(24(30)28-22-10-6-5-9-20(22)17-23(28)25(31)32)27-21(12-11-19-7-3-2-4-8-19)26(33)36-13-15-38-16-14-37-29(34)35/h2-10,18,21,23,27H,11-17H2,1H3,(H,31,32) |
| InChIKey | BXKFXNLSXRSTCW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|