C28H35N3O10 — CID 58862174
6,7-dimethoxy-2-[2-[[1-(3-nitrooxypropoxy)-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 58862174) has the molecular formula C28H35N3O10 and a molecular weight of 573.60 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[2-[[1-(3-nitrooxypropoxy)-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | 6,7-dimethoxy-2-[2-[[1-(3-nitrooxypropoxy)-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 58862174 |
| Molecular Formula | C28H35N3O10 |
| Molecular Weight | 573.60 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | 6,7-dimethoxy-2-[2-[[1-(3-nitrooxypropoxy)-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)C(C)NC(CCc1ccccc1)C(=O)OCCCO[N+](=O)[O-])C(C(=O)O)C2 |
| InChI | InChI=1S/C28H35N3O10/c1-18(26(32)30-17-21-16-25(39-3)24(38-2)15-20(21)14-23(30)27(33)34)29-22(11-10-19-8-5-4-6-9-19)28(35)40-12-7-13-41-31(36)37/h4-6,8-9,15-16,18,22-23,29H,7,10-14,17H2,1-3H3,(H,33,34) |
| InChIKey | QZVJAEQAQXSNAO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 166.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.60 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|