C27H33N3O10 — CID 11307498
5,6-dimethoxy-1-[2-[[1-(3-nitrooxypropoxy)-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-2,3-dihydroindole-2-carboxylic acid (PubChem CID 11307498) has the molecular formula C27H33N3O10 and a molecular weight of 559.57 g/mol. Its IUPAC name is 5,6-dimethoxy-1-[2-[[1-(3-nitrooxypropoxy)-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | 5,6-dimethoxy-1-[2-[[1-(3-nitrooxypropoxy)-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 11307498 |
| Molecular Formula | C27H33N3O10 |
| Molecular Weight | 559.57 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | 5,6-dimethoxy-1-[2-[[1-(3-nitrooxypropoxy)-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-2,3-dihydroindole-2-carboxylic acid |
| SMILES | COc1cc2c(cc1OC)N(C(=O)C(C)NC(CCc1ccccc1)C(=O)OCCCO[N+](=O)[O-])C(C(=O)O)C2 |
| InChI | InChI=1S/C27H33N3O10/c1-17(25(31)29-21-16-24(38-3)23(37-2)15-19(21)14-22(29)26(32)33)28-20(11-10-18-8-5-4-6-9-18)27(34)39-12-7-13-40-30(35)36/h4-6,8-9,15-17,20,22,28H,7,10-14H2,1-3H3,(H,32,33) |
| InChIKey | PGTYZAWOCSYZCU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 166.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.57 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|