C28H35NO7 — CID 124650199
(2S,3R)-3-[(2R)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid (PubChem CID 124650199) has the molecular formula C28H35NO7 and a molecular weight of 497.59 g/mol. Its IUPAC name is (2S,3R)-3-[(2R)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid.
| Compound Name | (2S,3R)-3-[(2R)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 124650199 |
| Molecular Formula | C28H35NO7 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | (2S,3R)-3-[(2R)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@H](C)C(=O)[C@@H]1Cc2cc(OC)c(OC)cc2C[C@@H]1C(=O)O |
| InChI | InChI=1S/C28H35NO7/c1-5-36-28(33)23(12-11-18-9-7-6-8-10-18)29-17(2)26(30)21-13-19-15-24(34-3)25(35-4)16-20(19)14-22(21)27(31)32/h6-10,15-17,21-23,29H,5,11-14H2,1-4H3,(H,31,32)/t17-,21-,22+,23+/m1/s1 |
| InChIKey | FAYBZSOZQDRROT-DZWOVHDNSA-N |
| XLogP | 3.23 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |