C23H32N4O9 — CID 11489061
3-nitrooxypropyl 3-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-1-methyl-2-oxoimidazolidine-4-carboxylate (PubChem CID 11489061) has the molecular formula C23H32N4O9 and a molecular weight of 508.53 g/mol. Its IUPAC name is 3-nitrooxypropyl 3-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-1-methyl-2-oxoimidazolidine-4-carboxylate.
| Compound Name | 3-nitrooxypropyl 3-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-1-methyl-2-oxoimidazolidine-4-carboxylate |
|---|---|
| PubChem CID | 11489061 |
| Molecular Formula | C23H32N4O9 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | 3-nitrooxypropyl 3-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-1-methyl-2-oxoimidazolidine-4-carboxylate |
| SMILES | CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N1C(=O)N(C)CC1C(=O)OCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C23H32N4O9/c1-4-34-21(29)18(12-11-17-9-6-5-7-10-17)24-16(2)20(28)26-19(15-25(3)23(26)31)22(30)35-13-8-14-36-27(32)33/h5-7,9-10,16,18-19,24H,4,8,11-15H2,1-3H3 |
| InChIKey | ICFBVGKLJXWVSS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 157.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|