C27H41N3O6 — CID 57115635
benzyl (4S)-3-[(2S)-2-[[(2S)-1-ethoxy-1-oxodecan-2-yl]amino]propanoyl]-1-methyl-2-oxoimidazolidine-4-carboxylate (PubChem CID 57115635) has the molecular formula C27H41N3O6 and a molecular weight of 503.64 g/mol. Its IUPAC name is benzyl (4S)-3-[(2S)-2-[[(2S)-1-ethoxy-1-oxodecan-2-yl]amino]propanoyl]-1-methyl-2-oxoimidazolidine-4-carboxylate.
| Compound Name | benzyl (4S)-3-[(2S)-2-[[(2S)-1-ethoxy-1-oxodecan-2-yl]amino]propanoyl]-1-methyl-2-oxoimidazolidine-4-carboxylate |
|---|---|
| PubChem CID | 57115635 |
| Molecular Formula | C27H41N3O6 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | benzyl (4S)-3-[(2S)-2-[[(2S)-1-ethoxy-1-oxodecan-2-yl]amino]propanoyl]-1-methyl-2-oxoimidazolidine-4-carboxylate |
| SMILES | CCCCCCCC[C@H](N[C@@H](C)C(=O)N1C(=O)N(C)C[C@H]1C(=O)OCc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C27H41N3O6/c1-5-7-8-9-10-14-17-22(25(32)35-6-2)28-20(3)24(31)30-23(18-29(4)27(30)34)26(33)36-19-21-15-12-11-13-16-21/h11-13,15-16,20,22-23,28H,5-10,14,17-19H2,1-4H3/t20-,22-,23-/m0/s1 |
| InChIKey | QMNLTDSSAQUUKO-PMVMPFDFSA-N |
| XLogP | 3.65 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|