C25H35N3O8 — CID 58862189
2-[[1-[2-(4-nitrooxybutoxycarbonyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoic acid (PubChem CID 58862189) has the molecular formula C25H35N3O8 and a molecular weight of 505.57 g/mol. Its IUPAC name is 2-[[1-[2-(4-nitrooxybutoxycarbonyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoic acid.
| Compound Name | 2-[[1-[2-(4-nitrooxybutoxycarbonyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 58862189 |
| Molecular Formula | C25H35N3O8 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 2-[[1-[2-(4-nitrooxybutoxycarbonyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-1-oxopropan-2-yl]amino]-4-phenylbutanoic acid |
| SMILES | CC(NC(CCc1ccccc1)C(=O)O)C(=O)N1C(C(=O)OCCCCO[N+](=O)[O-])CC2CCCC21 |
| InChI | InChI=1S/C25H35N3O8/c1-17(26-20(24(30)31)13-12-18-8-3-2-4-9-18)23(29)27-21-11-7-10-19(21)16-22(27)25(32)35-14-5-6-15-36-28(33)34/h2-4,8-9,17,19-22,26H,5-7,10-16H2,1H3,(H,30,31) |
| InChIKey | AJACKXQNHXHGHX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|