C21H34N4O5 — CID 91971498
diazanium;(2S,3aS,6aS)-1-[(2S)-2-[[(1S)-1-carboxylato-3-phenylpropyl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate (PubChem CID 91971498) has the molecular formula C21H34N4O5 and a molecular weight of 422.53 g/mol. Its IUPAC name is diazanium;(2S,3aS,6aS)-1-[(2S)-2-[[(1S)-1-carboxylato-3-phenylpropyl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate.
| Compound Name | diazanium;(2S,3aS,6aS)-1-[(2S)-2-[[(1S)-1-carboxylato-3-phenylpropyl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 91971498 |
| Molecular Formula | C21H34N4O5 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | diazanium;(2S,3aS,6aS)-1-[(2S)-2-[[(1S)-1-carboxylato-3-phenylpropyl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
| SMILES | C[C@H](N[C@@H](CCc1ccccc1)C(=O)[O-])C(=O)N1[C@H](C(=O)[O-])C[C@@H]2CCC[C@@H]21.[NH4+].[NH4+] |
| InChI | InChI=1S/C21H28N2O5.2H3N/c1-13(22-16(20(25)26)11-10-14-6-3-2-4-7-14)19(24)23-17-9-5-8-15(17)12-18(23)21(27)28;;/h2-4,6-7,13,15-18,22H,5,8-12H2,1H3,(H,25,26)(H,27,28);2*1H3/t13-,15-,16-,17-,18-;;/m0../s1 |
| InChIKey | UDDJSFAXRVIEJO-PKTBIWTGSA-N |
| XLogP | -0.01 |
| TPSA | 185.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |