C25H37N3O9 — CID 70339633
1-[2-[[1-[2-[2-(dihydroxyamino)oxyethoxy]ethoxy]-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid (PubChem CID 70339633) has the molecular formula C25H37N3O9 and a molecular weight of 523.58 g/mol. Its IUPAC name is 1-[2-[[1-[2-[2-(dihydroxyamino)oxyethoxy]ethoxy]-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid.
| Compound Name | 1-[2-[[1-[2-[2-(dihydroxyamino)oxyethoxy]ethoxy]-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 70339633 |
| Molecular Formula | C25H37N3O9 |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | 1-[2-[[1-[2-[2-(dihydroxyamino)oxyethoxy]ethoxy]-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid |
| SMILES | CC(NC(CCc1ccccc1)C(=O)OCCOCCON(O)O)C(=O)N1C(C(=O)O)CC2CCCC21 |
| InChI | InChI=1S/C25H37N3O9/c1-17(23(29)27-21-9-5-8-19(21)16-22(27)24(30)31)26-20(11-10-18-6-3-2-4-7-18)25(32)36-14-12-35-13-15-37-28(33)34/h2-4,6-7,17,19-22,26,33-34H,5,8-16H2,1H3,(H,30,31) |
| InChIKey | KRETVHKSXOPOQC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 158.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|