C24H34N2O6 — CID 58153671
(2S,3aS,6aS)-1-[(2S)-2-[[(2S)-1-ethoxy-4-(4-methoxyphenyl)-1-oxobutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid (PubChem CID 58153671) has the molecular formula C24H34N2O6 and a molecular weight of 446.54 g/mol. Its IUPAC name is (2S,3aS,6aS)-1-[(2S)-2-[[(2S)-1-ethoxy-4-(4-methoxyphenyl)-1-oxobutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid.
| Compound Name | (2S,3aS,6aS)-1-[(2S)-2-[[(2S)-1-ethoxy-4-(4-methoxyphenyl)-1-oxobutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 58153671 |
| Molecular Formula | C24H34N2O6 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | (2S,3aS,6aS)-1-[(2S)-2-[[(2S)-1-ethoxy-4-(4-methoxyphenyl)-1-oxobutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid |
| SMILES | CCOC(=O)[C@H](CCc1ccc(OC)cc1)N[C@@H](C)C(=O)N1[C@H](C(=O)O)C[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C24H34N2O6/c1-4-32-24(30)19(13-10-16-8-11-18(31-3)12-9-16)25-15(2)22(27)26-20-7-5-6-17(20)14-21(26)23(28)29/h8-9,11-12,15,17,19-21,25H,4-7,10,13-14H2,1-3H3,(H,28,29)/t15-,17-,19-,20-,21-/m0/s1 |
| InChIKey | RTJZIBHIHOYZET-JYBBTRFZSA-N |
| XLogP | 2.39 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |