C27H39N3O5 — CID 137347806
methyl (2S,3aS,6aS)-1-[(2S)-2-[[(2S)-4-[4-(azetidin-1-yl)phenyl]-1-ethoxy-1-oxobutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate (PubChem CID 137347806) has the molecular formula C27H39N3O5 and a molecular weight of 485.63 g/mol. Its IUPAC name is methyl (2S,3aS,6aS)-1-[(2S)-2-[[(2S)-4-[4-(azetidin-1-yl)phenyl]-1-ethoxy-1-oxobutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate.
| Compound Name | methyl (2S,3aS,6aS)-1-[(2S)-2-[[(2S)-4-[4-(azetidin-1-yl)phenyl]-1-ethoxy-1-oxobutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 137347806 |
| Molecular Formula | C27H39N3O5 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | methyl (2S,3aS,6aS)-1-[(2S)-2-[[(2S)-4-[4-(azetidin-1-yl)phenyl]-1-ethoxy-1-oxobutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)[C@H](CCc1ccc(N2CCC2)cc1)N[C@@H](C)C(=O)N1[C@H](C(=O)OC)C[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C27H39N3O5/c1-4-35-26(32)22(14-11-19-9-12-21(13-10-19)29-15-6-16-29)28-18(2)25(31)30-23-8-5-7-20(23)17-24(30)27(33)34-3/h9-10,12-13,18,20,22-24,28H,4-8,11,14-17H2,1-3H3/t18-,20-,22-,23-,24-/m0/s1 |
| InChIKey | FEHQNJDCADGXEP-CSZJILOISA-N |
| XLogP | 2.68 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|