C34H48N2O8 — CID 22844059
octyl (2S,3aS,6aS)-1-[(2S)-2-[[(2S)-1-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate (PubChem CID 22844059) has the molecular formula C34H48N2O8 and a molecular weight of 612.76 g/mol. Its IUPAC name is octyl (2S,3aS,6aS)-1-[(2S)-2-[[(2S)-1-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate.
| Compound Name | octyl (2S,3aS,6aS)-1-[(2S)-2-[[(2S)-1-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 22844059 |
| Molecular Formula | C34H48N2O8 |
| Molecular Weight | 612.76 g/mol |
| Exact Mass | 612.34 |
| IUPAC Name | octyl (2S,3aS,6aS)-1-[(2S)-2-[[(2S)-1-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methoxy]-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
| SMILES | CCCCCCCCOC(=O)[C@@H]1C[C@@H]2CCC[C@@H]2N1C(=O)[C@H](C)N[C@@H](CCc1ccccc1)C(=O)OCc1oc(=O)oc1C |
| InChI | InChI=1S/C34H48N2O8/c1-4-5-6-7-8-12-20-41-33(39)29-21-26-16-13-17-28(26)36(29)31(37)23(2)35-27(19-18-25-14-10-9-11-15-25)32(38)42-22-30-24(3)43-34(40)44-30/h9-11,14-15,23,26-29,35H,4-8,12-13,16-22H2,1-3H3/t23-,26-,27-,28-,29-/m0/s1 |
| InChIKey | RNAAYHQWWAAYST-CPFNYCBMSA-N |
| XLogP | 5.24 |
| TPSA | 128.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.76 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|