C28H42N2O4 — CID 14699666
octyl (2S,3aS,6aS)-1-[(2S)-2-(3-phenylpropanoylamino)propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate (PubChem CID 14699666) has the molecular formula C28H42N2O4 and a molecular weight of 470.65 g/mol. Its IUPAC name is octyl (2S,3aS,6aS)-1-[(2S)-2-(3-phenylpropanoylamino)propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate.
| Compound Name | octyl (2S,3aS,6aS)-1-[(2S)-2-(3-phenylpropanoylamino)propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 14699666 |
| Molecular Formula | C28H42N2O4 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | octyl (2S,3aS,6aS)-1-[(2S)-2-(3-phenylpropanoylamino)propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
| SMILES | CCCCCCCCOC(=O)[C@@H]1C[C@@H]2CCC[C@@H]2N1C(=O)[C@H](C)NC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C28H42N2O4/c1-3-4-5-6-7-11-19-34-28(33)25-20-23-15-12-16-24(23)30(25)27(32)21(2)29-26(31)18-17-22-13-9-8-10-14-22/h8-10,13-14,21,23-25H,3-7,11-12,15-20H2,1-2H3,(H,29,31)/t21-,23-,24-,25-/m0/s1 |
| InChIKey | LWZVSIYYKVNHRR-LFBFJMOVSA-N |
| XLogP | 4.80 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|