C27H39N3O8S — CID 11203840
2-(2-nitrooxyethylsulfanyl)ethyl 1-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate (PubChem CID 11203840) has the molecular formula C27H39N3O8S and a molecular weight of 565.69 g/mol. Its IUPAC name is 2-(2-nitrooxyethylsulfanyl)ethyl 1-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate.
| Compound Name | 2-(2-nitrooxyethylsulfanyl)ethyl 1-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 11203840 |
| Molecular Formula | C27H39N3O8S |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | 2-(2-nitrooxyethylsulfanyl)ethyl 1-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N1C(C(=O)OCCSCCO[N+](=O)[O-])CC2CCCC21 |
| InChI | InChI=1S/C27H39N3O8S/c1-3-36-26(32)22(13-12-20-8-5-4-6-9-20)28-19(2)25(31)29-23-11-7-10-21(23)18-24(29)27(33)37-14-16-39-17-15-38-30(34)35/h4-6,8-9,19,21-24,28H,3,7,10-18H2,1-2H3 |
| InChIKey | PZABAFKOYJGZRH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|