C28H38N2O11 — CID 75213094
6-[1-[2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 75213094) has the molecular formula C28H38N2O11 and a molecular weight of 578.62 g/mol. Its IUPAC name is 6-[1-[2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[1-[2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 75213094 |
| Molecular Formula | C28H38N2O11 |
| Molecular Weight | 578.62 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | 6-[1-[2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC(NC(CCc1ccccc1)C(=O)O)C(=O)N1C(C(=O)OC2OC(C(=O)O)C(O)C(O)C2O)CC2CCCCC21 |
| InChI | InChI=1S/C28H38N2O11/c1-14(29-17(25(35)36)12-11-15-7-3-2-4-8-15)24(34)30-18-10-6-5-9-16(18)13-19(30)27(39)41-28-22(33)20(31)21(32)23(40-28)26(37)38/h2-4,7-8,14,16-23,28-29,31-33H,5-6,9-13H2,1H3,(H,35,36)(H,37,38) |
| InChIKey | ZEDQQJMZPSYJNF-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 203.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.62 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |