C23H31N3O6 — CID 129407436
(2R,3aR,7aR)-6-acetyl-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]propanoyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-2-carboxylic acid (PubChem CID 129407436) has the molecular formula C23H31N3O6 and a molecular weight of 445.52 g/mol. Its IUPAC name is (2R,3aR,7aR)-6-acetyl-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]propanoyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-2-carboxylic acid.
| Compound Name | (2R,3aR,7aR)-6-acetyl-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]propanoyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 129407436 |
| Molecular Formula | C23H31N3O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | (2R,3aR,7aR)-6-acetyl-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]propanoyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-2-carboxylic acid |
| SMILES | CC(=O)N1CC[C@@H]2C[C@H](C(=O)O)N(C(=O)[C@H](C)N[C@@H](CCc3ccccc3)C(=O)O)[C@H]2C1 |
| InChI | InChI=1S/C23H31N3O6/c1-14(24-18(22(29)30)9-8-16-6-4-3-5-7-16)21(28)26-19(23(31)32)12-17-10-11-25(15(2)27)13-20(17)26/h3-7,14,17-20,24H,8-13H2,1-2H3,(H,29,30)(H,31,32)/t14-,17+,18-,19+,20-/m0/s1 |
| InChIKey | YEZVZDFOQSWODX-AXBXVSCFSA-N |
| XLogP | 0.97 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |