C27H39N3O6 — CID 99940914
(2R,3aR,7aR)-1-[(2R)-2-[[(1R)-1-carboxy-3-phenylpropyl]amino]propanoyl]-6-hexanoyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-2-carboxylic acid (PubChem CID 99940914) has the molecular formula C27H39N3O6 and a molecular weight of 501.62 g/mol. Its IUPAC name is (2R,3aR,7aR)-1-[(2R)-2-[[(1R)-1-carboxy-3-phenylpropyl]amino]propanoyl]-6-hexanoyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-2-carboxylic acid.
| Compound Name | (2R,3aR,7aR)-1-[(2R)-2-[[(1R)-1-carboxy-3-phenylpropyl]amino]propanoyl]-6-hexanoyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 99940914 |
| Molecular Formula | C27H39N3O6 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | (2R,3aR,7aR)-1-[(2R)-2-[[(1R)-1-carboxy-3-phenylpropyl]amino]propanoyl]-6-hexanoyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-2-carboxylic acid |
| SMILES | CCCCCC(=O)N1CC[C@@H]2C[C@H](C(=O)O)N(C(=O)[C@@H](C)N[C@H](CCc3ccccc3)C(=O)O)[C@H]2C1 |
| InChI | InChI=1S/C27H39N3O6/c1-3-4-6-11-24(31)29-15-14-20-16-22(27(35)36)30(23(20)17-29)25(32)18(2)28-21(26(33)34)13-12-19-9-7-5-8-10-19/h5,7-10,18,20-23,28H,3-4,6,11-17H2,1-2H3,(H,33,34)(H,35,36)/t18-,20-,21-,22-,23+/m1/s1 |
| InChIKey | YLWLIDJVICAADS-KNQBKSORSA-N |
| XLogP | 2.53 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|