C16H29NO4S — CID 531529
methyl 2-(hexanoylamino)-3-hexanoylsulfanylpropanoate (PubChem CID 531529) has the molecular formula C16H29NO4S and a molecular weight of 331.48 g/mol. Its IUPAC name is methyl 2-(hexanoylamino)-3-hexanoylsulfanylpropanoate.
| Compound Name | methyl 2-(hexanoylamino)-3-hexanoylsulfanylpropanoate |
|---|---|
| PubChem CID | 531529 |
| Molecular Formula | C16H29NO4S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | methyl 2-(hexanoylamino)-3-hexanoylsulfanylpropanoate |
| SMILES | CCCCCC(=O)NC(CSC(=O)CCCCC)C(=O)OC |
| InChI | InChI=1S/C16H29NO4S/c1-4-6-8-10-14(18)17-13(16(20)21-3)12-22-15(19)11-9-7-5-2/h13H,4-12H2,1-3H3,(H,17,18) |
| InChIKey | YCIZSACBLKKKCO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|