C18H34N2O5S2 — CID 87750469
methyl 2-amino-3-[[(2R)-2-(decanoylamino)-3-methoxy-3-oxopropyl]disulfanyl]propanoate (PubChem CID 87750469) has the molecular formula C18H34N2O5S2 and a molecular weight of 422.61 g/mol. Its IUPAC name is methyl 2-amino-3-[[(2R)-2-(decanoylamino)-3-methoxy-3-oxopropyl]disulfanyl]propanoate.
| Compound Name | methyl 2-amino-3-[[(2R)-2-(decanoylamino)-3-methoxy-3-oxopropyl]disulfanyl]propanoate |
|---|---|
| PubChem CID | 87750469 |
| Molecular Formula | C18H34N2O5S2 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | methyl 2-amino-3-[[(2R)-2-(decanoylamino)-3-methoxy-3-oxopropyl]disulfanyl]propanoate |
| SMILES | CCCCCCCCCC(=O)N[C@@H](CSSCC(N)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C18H34N2O5S2/c1-4-5-6-7-8-9-10-11-16(21)20-15(18(23)25-3)13-27-26-12-14(19)17(22)24-2/h14-15H,4-13,19H2,1-3H3,(H,20,21)/t14?,15-/m0/s1 |
| InChIKey | PAJISBYUKKCRGD-LOACHALJSA-N |
| XLogP | 2.67 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|