C26H48N2O6S2 — CID 23185098
3-[[2-carboxy-2-(decanoylamino)ethyl]disulfanyl]-2-(decanoylamino)propanoic acid (PubChem CID 23185098) has the molecular formula C26H48N2O6S2 and a molecular weight of 548.81 g/mol. Its IUPAC name is 3-[[2-carboxy-2-(decanoylamino)ethyl]disulfanyl]-2-(decanoylamino)propanoic acid.
| Compound Name | 3-[[2-carboxy-2-(decanoylamino)ethyl]disulfanyl]-2-(decanoylamino)propanoic acid |
|---|---|
| PubChem CID | 23185098 |
| Molecular Formula | C26H48N2O6S2 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | 3-[[2-carboxy-2-(decanoylamino)ethyl]disulfanyl]-2-(decanoylamino)propanoic acid |
| SMILES | CCCCCCCCCC(=O)NC(CSSCC(NC(=O)CCCCCCCCC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C26H48N2O6S2/c1-3-5-7-9-11-13-15-17-23(29)27-21(25(31)32)19-35-36-20-22(26(33)34)28-24(30)18-16-14-12-10-8-6-4-2/h21-22H,3-20H2,1-2H3,(H,27,29)(H,28,30)(H,31,32)(H,33,34) |
| InChIKey | JKSQFVVKSGSDIX-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|