C30H58N4O6S2 — CID 89495809
3-[[2-carboxy-2-[10-(dimethylamino)decanoylamino]ethyl]disulfanyl]-2-[10-(dimethylamino)decanoylamino]propanoic acid (PubChem CID 89495809) has the molecular formula C30H58N4O6S2 and a molecular weight of 634.95 g/mol. Its IUPAC name is 3-[[2-carboxy-2-[10-(dimethylamino)decanoylamino]ethyl]disulfanyl]-2-[10-(dimethylamino)decanoylamino]propanoic acid.
| Compound Name | 3-[[2-carboxy-2-[10-(dimethylamino)decanoylamino]ethyl]disulfanyl]-2-[10-(dimethylamino)decanoylamino]propanoic acid |
|---|---|
| PubChem CID | 89495809 |
| Molecular Formula | C30H58N4O6S2 |
| Molecular Weight | 634.95 g/mol |
| Exact Mass | 634.38 |
| IUPAC Name | 3-[[2-carboxy-2-[10-(dimethylamino)decanoylamino]ethyl]disulfanyl]-2-[10-(dimethylamino)decanoylamino]propanoic acid |
| SMILES | CN(C)CCCCCCCCCC(=O)NC(CSSCC(NC(=O)CCCCCCCCCN(C)C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C30H58N4O6S2/c1-33(2)21-17-13-9-5-7-11-15-19-27(35)31-25(29(37)38)23-41-42-24-26(30(39)40)32-28(36)20-16-12-8-6-10-14-18-22-34(3)4/h25-26H,5-24H2,1-4H3,(H,31,35)(H,32,36)(H,37,38)(H,39,40) |
| InChIKey | VPTSYTMHMVBWQQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.95 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|