C32H62N4O6S2 — CID 89495878
4-[[3-carboxy-3-[10-(dimethylamino)decanoylamino]propyl]disulfanyl]-2-[10-(dimethylamino)decanoylamino]butanoic acid (PubChem CID 89495878) has the molecular formula C32H62N4O6S2 and a molecular weight of 663.00 g/mol. Its IUPAC name is 4-[[3-carboxy-3-[10-(dimethylamino)decanoylamino]propyl]disulfanyl]-2-[10-(dimethylamino)decanoylamino]butanoic acid.
| Compound Name | 4-[[3-carboxy-3-[10-(dimethylamino)decanoylamino]propyl]disulfanyl]-2-[10-(dimethylamino)decanoylamino]butanoic acid |
|---|---|
| PubChem CID | 89495878 |
| Molecular Formula | C32H62N4O6S2 |
| Molecular Weight | 663.00 g/mol |
| Exact Mass | 662.41 |
| IUPAC Name | 4-[[3-carboxy-3-[10-(dimethylamino)decanoylamino]propyl]disulfanyl]-2-[10-(dimethylamino)decanoylamino]butanoic acid |
| SMILES | CN(C)CCCCCCCCCC(=O)NC(CCSSCCC(NC(=O)CCCCCCCCCN(C)C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C32H62N4O6S2/c1-35(2)23-17-13-9-5-7-11-15-19-29(37)33-27(31(39)40)21-25-43-44-26-22-28(32(41)42)34-30(38)20-16-12-8-6-10-14-18-24-36(3)4/h27-28H,5-26H2,1-4H3,(H,33,37)(H,34,38)(H,39,40)(H,41,42) |
| InChIKey | QEJXJBZHMANKID-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.00 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|