C13H26N2O3S — CID 129089625
2-[8-(dimethylamino)octanoylamino]-3-sulfanylpropanoic acid (PubChem CID 129089625) has the molecular formula C13H26N2O3S and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-[8-(dimethylamino)octanoylamino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[8-(dimethylamino)octanoylamino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 129089625 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-[8-(dimethylamino)octanoylamino]-3-sulfanylpropanoic acid |
| SMILES | CN(C)CCCCCCCC(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C13H26N2O3S/c1-15(2)9-7-5-3-4-6-8-12(16)14-11(10-19)13(17)18/h11,19H,3-10H2,1-2H3,(H,14,16)(H,17,18) |
| InChIKey | JURHNWPBKXANEY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|