C26H52N4O6S2 — CID 129089609
3-[[2-[8-(dimethylamino)octanoylamino]-3-hydroxy-3-methoxypropyl]disulfanyl]-2-[8-(methylamino)octanoylamino]propanoic acid (PubChem CID 129089609) has the molecular formula C26H52N4O6S2 and a molecular weight of 580.86 g/mol. Its IUPAC name is 3-[[2-[8-(dimethylamino)octanoylamino]-3-hydroxy-3-methoxypropyl]disulfanyl]-2-[8-(methylamino)octanoylamino]propanoic acid.
| Compound Name | 3-[[2-[8-(dimethylamino)octanoylamino]-3-hydroxy-3-methoxypropyl]disulfanyl]-2-[8-(methylamino)octanoylamino]propanoic acid |
|---|---|
| PubChem CID | 129089609 |
| Molecular Formula | C26H52N4O6S2 |
| Molecular Weight | 580.86 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | 3-[[2-[8-(dimethylamino)octanoylamino]-3-hydroxy-3-methoxypropyl]disulfanyl]-2-[8-(methylamino)octanoylamino]propanoic acid |
| SMILES | CNCCCCCCCC(=O)NC(CSSCC(NC(=O)CCCCCCCN(C)C)C(O)OC)C(=O)O |
| InChI | InChI=1S/C26H52N4O6S2/c1-27-17-13-9-5-7-11-15-23(31)28-21(25(33)34)19-37-38-20-22(26(35)36-4)29-24(32)16-12-8-6-10-14-18-30(2)3/h21-22,26-27,35H,5-20H2,1-4H3,(H,28,31)(H,29,32)(H,33,34) |
| InChIKey | QHSPBMGEPVTKLQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.86 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|