C15H28ClN5O7S2 — CID 10184882
4-nitrooxybutyl (2R)-2-acetamido-3-[2-amino-5-(carbamothioylamino)pentanoyl]sulfanylpropanoate;hydrochloride (PubChem CID 10184882) has the molecular formula C15H28ClN5O7S2 and a molecular weight of 490.00 g/mol. Its IUPAC name is 4-nitrooxybutyl (2R)-2-acetamido-3-[2-amino-5-(carbamothioylamino)pentanoyl]sulfanylpropanoate;hydrochloride.
| Compound Name | 4-nitrooxybutyl (2R)-2-acetamido-3-[2-amino-5-(carbamothioylamino)pentanoyl]sulfanylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 10184882 |
| Molecular Formula | C15H28ClN5O7S2 |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 4-nitrooxybutyl (2R)-2-acetamido-3-[2-amino-5-(carbamothioylamino)pentanoyl]sulfanylpropanoate;hydrochloride |
| SMILES | CC(=O)N[C@@H](CSC(=O)C(N)CCCNC(N)=S)C(=O)OCCCCO[N+](=O)[O-].Cl |
| InChI | InChI=1S/C15H27N5O7S2.ClH/c1-10(21)19-12(13(22)26-7-2-3-8-27-20(24)25)9-29-14(23)11(16)5-4-6-18-15(17)28;/h11-12H,2-9,16H2,1H3,(H,19,21)(H3,17,18,28);1H/t11?,12-;/m0./s1 |
| InChIKey | ZPFHQELDNMQPFO-MMFRDWCLSA-N |
| XLogP | -0.35 |
| TPSA | 188.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|