C10H17NO4S — CID 57061371
ethyl (2R)-2-acetamido-3-propanoylsulfanylpropanoate (PubChem CID 57061371) has the molecular formula C10H17NO4S and a molecular weight of 247.32 g/mol. Its IUPAC name is ethyl (2R)-2-acetamido-3-propanoylsulfanylpropanoate.
| Compound Name | ethyl (2R)-2-acetamido-3-propanoylsulfanylpropanoate |
|---|---|
| PubChem CID | 57061371 |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | ethyl (2R)-2-acetamido-3-propanoylsulfanylpropanoate |
| SMILES | CCOC(=O)[C@H](CSC(=O)CC)NC(C)=O |
| InChI | InChI=1S/C10H17NO4S/c1-4-9(13)16-6-8(11-7(3)12)10(14)15-5-2/h8H,4-6H2,1-3H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | QHUNEDWCMDUHQS-QMMMGPOBSA-N |
| XLogP | 0.72 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|